C18H22N6O4S — CID 122294021
N-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]-2-oxo-3H-1,3-benzoxazole-5-sulfonamide (PubChem CID 122294021) has the molecular formula C18H22N6O4S and a molecular weight of 418.48 g/mol. Its IUPAC name is N-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]-2-oxo-3H-1,3-benzoxazole-5-sulfonamide.
| Compound Name | N-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]-2-oxo-3H-1,3-benzoxazole-5-sulfonamide |
|---|---|
| PubChem CID | 122294021 |
| Molecular Formula | C18H22N6O4S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-[2-[(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]-2-oxo-3H-1,3-benzoxazole-5-sulfonamide |
| SMILES | Cc1nc(NCCNS(=O)(=O)c2ccc3oc(=O)[nH]c3c2)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C18H22N6O4S/c1-12-21-16(11-17(22-12)24-8-2-3-9-24)19-6-7-20-29(26,27)13-4-5-15-14(10-13)23-18(25)28-15/h4-5,10-11,20H,2-3,6-9H2,1H3,(H,23,25)(H,19,21,22) |
| InChIKey | OIWVWJYTOBXUAN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|