C17H22N6O5S — CID 121074909
N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-4-nitrobenzenesulfonamide (PubChem CID 121074909) has the molecular formula C17H22N6O5S and a molecular weight of 422.47 g/mol. Its IUPAC name is N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 121074909 |
| Molecular Formula | C17H22N6O5S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-4-nitrobenzenesulfonamide |
| SMILES | Cc1nc(NCCNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C17H22N6O5S/c1-13-20-16(12-17(21-13)22-8-10-28-11-9-22)18-6-7-19-29(26,27)15-4-2-14(3-5-15)23(24)25/h2-5,12,19H,6-11H2,1H3,(H,18,20,21) |
| InChIKey | QJKVMSWJEWMPJR-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|