C17H21Cl2N5O3S — CID 121074892
2,5-dichloro-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide (PubChem CID 121074892) has the molecular formula C17H21Cl2N5O3S and a molecular weight of 446.36 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121074892 |
| Molecular Formula | C17H21Cl2N5O3S |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 2,5-dichloro-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide |
| SMILES | Cc1nc(NCCNS(=O)(=O)c2cc(Cl)ccc2Cl)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C17H21Cl2N5O3S/c1-12-22-16(11-17(23-12)24-6-8-27-9-7-24)20-4-5-21-28(25,26)15-10-13(18)2-3-14(15)19/h2-3,10-11,21H,4-9H2,1H3,(H,20,22,23) |
| InChIKey | ZENBUAIRALKJAD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|