C19H27N5O4S — CID 122294281
N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-2-phenoxyethanesulfonamide (PubChem CID 122294281) has the molecular formula C19H27N5O4S and a molecular weight of 421.52 g/mol. Its IUPAC name is N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-2-phenoxyethanesulfonamide.
| Compound Name | N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-2-phenoxyethanesulfonamide |
|---|---|
| PubChem CID | 122294281 |
| Molecular Formula | C19H27N5O4S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-2-phenoxyethanesulfonamide |
| SMILES | Cc1nc(NCCNS(=O)(=O)CCOc2ccccc2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H27N5O4S/c1-16-22-18(15-19(23-16)24-9-11-27-12-10-24)20-7-8-21-29(25,26)14-13-28-17-5-3-2-4-6-17/h2-6,15,21H,7-14H2,1H3,(H,20,22,23) |
| InChIKey | HVRFVASIYGBLPO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|