C20H25ClFN5O2 — CID 122294239
3-(3-chloro-4-fluorophenyl)-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]propanamide (PubChem CID 122294239) has the molecular formula C20H25ClFN5O2 and a molecular weight of 421.90 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]propanamide.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]propanamide |
|---|---|
| PubChem CID | 122294239 |
| Molecular Formula | C20H25ClFN5O2 |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]propanamide |
| SMILES | Cc1nc(NCCNC(=O)CCc2ccc(F)c(Cl)c2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H25ClFN5O2/c1-14-25-18(13-19(26-14)27-8-10-29-11-9-27)23-6-7-24-20(28)5-3-15-2-4-17(22)16(21)12-15/h2,4,12-13H,3,5-11H2,1H3,(H,24,28)(H,23,25,26) |
| InChIKey | LWDCFESWLVBCTD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|