C19H24ClN5O2 — CID 122327995
3-(3-chlorophenyl)-N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]propanamide (PubChem CID 122327995) has the molecular formula C19H24ClN5O2 and a molecular weight of 389.89 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]propanamide.
| Compound Name | 3-(3-chlorophenyl)-N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]propanamide |
|---|---|
| PubChem CID | 122327995 |
| Molecular Formula | C19H24ClN5O2 |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 3-(3-chlorophenyl)-N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]propanamide |
| SMILES | O=C(CCc1cccc(Cl)c1)NCCNc1cc(N2CCOCC2)ncn1 |
| InChI | InChI=1S/C19H24ClN5O2/c20-16-3-1-2-15(12-16)4-5-19(26)22-7-6-21-17-13-18(24-14-23-17)25-8-10-27-11-9-25/h1-3,12-14H,4-11H2,(H,22,26)(H,21,23,24) |
| InChIKey | RZIORDHXDCFWFG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|