C23H30ClN5O2 — CID 122294119
1-(4-chlorophenyl)-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]cyclopentane-1-carboxamide (PubChem CID 122294119) has the molecular formula C23H30ClN5O2 and a molecular weight of 443.98 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]cyclopentane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 122294119 |
| Molecular Formula | C23H30ClN5O2 |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]cyclopentane-1-carboxamide |
| SMILES | Cc1nc(NCCNC(=O)C2(c3ccc(Cl)cc3)CCCC2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C23H30ClN5O2/c1-17-27-20(16-21(28-17)29-12-14-31-15-13-29)25-10-11-26-22(30)23(8-2-3-9-23)18-4-6-19(24)7-5-18/h4-7,16H,2-3,8-15H2,1H3,(H,26,30)(H,25,27,28) |
| InChIKey | BAJLDLNGNRVXEQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|