C18H23ClN6O2 — CID 121074997
1-(4-chlorophenyl)-3-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]urea (PubChem CID 121074997) has the molecular formula C18H23ClN6O2 and a molecular weight of 390.88 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 121074997 |
| Molecular Formula | C18H23ClN6O2 |
| Molecular Weight | 390.88 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]urea |
| SMILES | Cc1nc(NCCNC(=O)Nc2ccc(Cl)cc2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H23ClN6O2/c1-13-22-16(12-17(23-13)25-8-10-27-11-9-25)20-6-7-21-18(26)24-15-4-2-14(19)3-5-15/h2-5,12H,6-11H2,1H3,(H,20,22,23)(H2,21,24,26) |
| InChIKey | BERGIAIVYAUMMZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.88 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|