C16H20N6O5S — CID 122321788
N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]-4-nitrobenzenesulfonamide (PubChem CID 122321788) has the molecular formula C16H20N6O5S and a molecular weight of 408.44 g/mol. Its IUPAC name is N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 122321788 |
| Molecular Formula | C16H20N6O5S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]-4-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)NCCNc2cc(N3CCOCC3)cnn2)cc1 |
| InChI | InChI=1S/C16H20N6O5S/c23-22(24)13-1-3-15(4-2-13)28(25,26)19-6-5-17-16-11-14(12-18-20-16)21-7-9-27-10-8-21/h1-4,11-12,19H,5-10H2,(H,17,20) |
| InChIKey | FFEPPHFIFJGVMJ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|