C16H20BrN5O2S — CID 122321369
2-bromo-N-[2-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide (PubChem CID 122321369) has the molecular formula C16H20BrN5O2S and a molecular weight of 426.34 g/mol. Its IUPAC name is 2-bromo-N-[2-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 2-bromo-N-[2-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122321369 |
| Molecular Formula | C16H20BrN5O2S |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 2-bromo-N-[2-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCNc1cc(N2CCCC2)cnn1)c1ccccc1Br |
| InChI | InChI=1S/C16H20BrN5O2S/c17-14-5-1-2-6-15(14)25(23,24)20-8-7-18-16-11-13(12-19-21-16)22-9-3-4-10-22/h1-2,5-6,11-12,20H,3-4,7-10H2,(H,18,21) |
| InChIKey | RHQQEFFLEAUVOL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|