C16H19ClFN5O3S — CID 122321698
3-chloro-4-fluoro-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide (PubChem CID 122321698) has the molecular formula C16H19ClFN5O3S and a molecular weight of 415.88 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 3-chloro-4-fluoro-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122321698 |
| Molecular Formula | C16H19ClFN5O3S |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 3-chloro-4-fluoro-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCNc1cc(N2CCOCC2)cnn1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H19ClFN5O3S/c17-14-10-13(1-2-15(14)18)27(24,25)21-4-3-19-16-9-12(11-20-22-16)23-5-7-26-8-6-23/h1-2,9-11,21H,3-8H2,(H,19,22) |
| InChIKey | CBYNUQZRCTUVDU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|