C17H22ClN5O4S — CID 122328127
3-chloro-4-methoxy-N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide (PubChem CID 122328127) has the molecular formula C17H22ClN5O4S and a molecular weight of 427.91 g/mol. Its IUPAC name is 3-chloro-4-methoxy-N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 3-chloro-4-methoxy-N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122328127 |
| Molecular Formula | C17H22ClN5O4S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 3-chloro-4-methoxy-N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCNc2cc(N3CCOCC3)ncn2)cc1Cl |
| InChI | InChI=1S/C17H22ClN5O4S/c1-26-15-3-2-13(10-14(15)18)28(24,25)22-5-4-19-16-11-17(21-12-20-16)23-6-8-27-9-7-23/h2-3,10-12,22H,4-9H2,1H3,(H,19,20,21) |
| InChIKey | PRALCJFARPCFOY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|