C20H24N6O5S — CID 122328122
4-(2,5-dioxopyrrolidin-1-yl)-N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide (PubChem CID 122328122) has the molecular formula C20H24N6O5S and a molecular weight of 460.52 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122328122 |
| Molecular Formula | C20H24N6O5S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide |
| SMILES | O=C1CCC(=O)N1c1ccc(S(=O)(=O)NCCNc2cc(N3CCOCC3)ncn2)cc1 |
| InChI | InChI=1S/C20H24N6O5S/c27-19-5-6-20(28)26(19)15-1-3-16(4-2-15)32(29,30)24-8-7-21-17-13-18(23-14-22-17)25-9-11-31-12-10-25/h1-4,13-14,24H,5-12H2,(H,21,22,23) |
| InChIKey | VGSKHVKHCICCFU-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|