C21H23N7O4S — CID 122289789
N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]-4-(2,5-dioxopyrrolidin-1-yl)benzenesulfonamide (PubChem CID 122289789) has the molecular formula C21H23N7O4S and a molecular weight of 469.53 g/mol. Its IUPAC name is N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]-4-(2,5-dioxopyrrolidin-1-yl)benzenesulfonamide.
| Compound Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]-4-(2,5-dioxopyrrolidin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 122289789 |
| Molecular Formula | C21H23N7O4S |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]-4-(2,5-dioxopyrrolidin-1-yl)benzenesulfonamide |
| SMILES | Cc1cc(C)n(-c2cc(NCCNS(=O)(=O)c3ccc(N4C(=O)CCC4=O)cc3)ncn2)n1 |
| InChI | InChI=1S/C21H23N7O4S/c1-14-11-15(2)28(26-14)19-12-18(23-13-24-19)22-9-10-25-33(31,32)17-5-3-16(4-6-17)27-20(29)7-8-21(27)30/h3-6,11-13,25H,7-10H2,1-2H3,(H,22,23,24) |
| InChIKey | CAKRQLLLGIDIFU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|