C18H26N8O2S — CID 122289779
N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]-1-ethyl-3,5-dimethylpyrazole-4-sulfonamide (PubChem CID 122289779) has the molecular formula C18H26N8O2S and a molecular weight of 418.53 g/mol. Its IUPAC name is N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]-1-ethyl-3,5-dimethylpyrazole-4-sulfonamide.
| Compound Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]-1-ethyl-3,5-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 122289779 |
| Molecular Formula | C18H26N8O2S |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]-1-ethyl-3,5-dimethylpyrazole-4-sulfonamide |
| SMILES | CCn1nc(C)c(S(=O)(=O)NCCNc2cc(-n3nc(C)cc3C)ncn2)c1C |
| InChI | InChI=1S/C18H26N8O2S/c1-6-25-15(5)18(14(4)24-25)29(27,28)22-8-7-19-16-10-17(21-11-20-16)26-13(3)9-12(2)23-26/h9-11,22H,6-8H2,1-5H3,(H,19,20,21) |
| InChIKey | FQRIVIZVWVVKCO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|