C16H27N7O2S — CID 122295568
N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-1-ethyl-3,5-dimethylpyrazole-4-sulfonamide (PubChem CID 122295568) has the molecular formula C16H27N7O2S and a molecular weight of 381.51 g/mol. Its IUPAC name is N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-1-ethyl-3,5-dimethylpyrazole-4-sulfonamide.
| Compound Name | N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-1-ethyl-3,5-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 122295568 |
| Molecular Formula | C16H27N7O2S |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-1-ethyl-3,5-dimethylpyrazole-4-sulfonamide |
| SMILES | CCn1nc(C)c(S(=O)(=O)NCCNc2nc(C)cc(N(C)C)n2)c1C |
| InChI | InChI=1S/C16H27N7O2S/c1-7-23-13(4)15(12(3)21-23)26(24,25)18-9-8-17-16-19-11(2)10-14(20-16)22(5)6/h10,18H,7-9H2,1-6H3,(H,17,19,20) |
| InChIKey | GKWCSPCKMWTZJD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|