C18H24N6O3S — CID 122295579
N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide (PubChem CID 122295579) has the molecular formula C18H24N6O3S and a molecular weight of 404.50 g/mol. Its IUPAC name is N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide.
| Compound Name | N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 122295579 |
| Molecular Formula | C18H24N6O3S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide |
| SMILES | Cc1cc(N(C)C)nc(NCCNS(=O)(=O)c2ccc3c(c2)CCC(=O)N3)n1 |
| InChI | InChI=1S/C18H24N6O3S/c1-12-10-16(24(2)3)23-18(21-12)19-8-9-20-28(26,27)14-5-6-15-13(11-14)4-7-17(25)22-15/h5-6,10-11,20H,4,7-9H2,1-3H3,(H,22,25)(H,19,21,23) |
| InChIKey | QERBJXFZFWVPIN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|