C15H20ClN5O2S — CID 121075572
3-chloro-N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]benzenesulfonamide (PubChem CID 121075572) has the molecular formula C15H20ClN5O2S and a molecular weight of 369.88 g/mol. Its IUPAC name is 3-chloro-N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121075572 |
| Molecular Formula | C15H20ClN5O2S |
| Molecular Weight | 369.88 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 3-chloro-N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
| SMILES | Cc1cc(N(C)C)nc(NCCNS(=O)(=O)c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C15H20ClN5O2S/c1-11-9-14(21(2)3)20-15(19-11)17-7-8-18-24(22,23)13-6-4-5-12(16)10-13/h4-6,9-10,18H,7-8H2,1-3H3,(H,17,19,20) |
| InChIKey | WXVLDEOWZYHSBV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.88 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|