C26H30N6O2S — CID 138646923
6-(dimethylamino)-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]naphthalene-2-sulfonamide (PubChem CID 138646923) has the molecular formula C26H30N6O2S and a molecular weight of 490.63 g/mol. Its IUPAC name is 6-(dimethylamino)-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]naphthalene-2-sulfonamide.
| Compound Name | 6-(dimethylamino)-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 138646923 |
| Molecular Formula | C26H30N6O2S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 6-(dimethylamino)-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]naphthalene-2-sulfonamide |
| SMILES | Cc1ccc(Nc2cc(C)nc(NCCNS(=O)(=O)c3ccc4cc(N(C)C)ccc4c3)n2)cc1 |
| InChI | InChI=1S/C26H30N6O2S/c1-18-5-9-22(10-6-18)30-25-15-19(2)29-26(31-25)27-13-14-28-35(33,34)24-12-8-20-16-23(32(3)4)11-7-21(20)17-24/h5-12,15-17,28H,13-14H2,1-4H3,(H2,27,29,30,31) |
| InChIKey | DRGYGBDXZMWPOK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|