C20H22N6O4S — CID 122325254
N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]-3-nitrobenzenesulfonamide (PubChem CID 122325254) has the molecular formula C20H22N6O4S and a molecular weight of 442.50 g/mol. Its IUPAC name is N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 122325254 |
| Molecular Formula | C20H22N6O4S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]-3-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(Nc2cc(C)nc(NCCNS(=O)(=O)c3cccc([N+](=O)[O-])c3)n2)cc1 |
| InChI | InChI=1S/C20H22N6O4S/c1-14-6-8-16(9-7-14)24-19-12-15(2)23-20(25-19)21-10-11-22-31(29,30)18-5-3-4-17(13-18)26(27)28/h3-9,12-13,22H,10-11H2,1-2H3,(H2,21,23,24,25) |
| InChIKey | VFNCRGGVXHEICG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 139.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|