C20H21ClFN5O3S — CID 122294762
3-chloro-4-fluoro-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]benzenesulfonamide (PubChem CID 122294762) has the molecular formula C20H21ClFN5O3S and a molecular weight of 465.94 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 3-chloro-4-fluoro-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122294762 |
| Molecular Formula | C20H21ClFN5O3S |
| Molecular Weight | 465.94 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 3-chloro-4-fluoro-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
| SMILES | COc1ccc(Nc2cc(C)nc(NCCNS(=O)(=O)c3ccc(F)c(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C20H21ClFN5O3S/c1-13-11-19(26-14-3-5-15(30-2)6-4-14)27-20(25-13)23-9-10-24-31(28,29)16-7-8-18(22)17(21)12-16/h3-8,11-12,24H,9-10H2,1-2H3,(H2,23,25,26,27) |
| InChIKey | DOHRJNVEMLCDJI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.94 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|