C20H25N5O3S2 — CID 122294759
5-ethyl-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]thiophene-2-sulfonamide (PubChem CID 122294759) has the molecular formula C20H25N5O3S2 and a molecular weight of 447.59 g/mol. Its IUPAC name is 5-ethyl-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 122294759 |
| Molecular Formula | C20H25N5O3S2 |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 5-ethyl-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCCNc2nc(C)cc(Nc3ccc(OC)cc3)n2)s1 |
| InChI | InChI=1S/C20H25N5O3S2/c1-4-17-9-10-19(29-17)30(26,27)22-12-11-21-20-23-14(2)13-18(25-20)24-15-5-7-16(28-3)8-6-15/h5-10,13,22H,4,11-12H2,1-3H3,(H2,21,23,24,25) |
| InChIKey | PQRAERJGOCYYOD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|