C19H25N7O3S — CID 122294781
N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 122294781) has the molecular formula C19H25N7O3S and a molecular weight of 431.52 g/mol. Its IUPAC name is N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 122294781 |
| Molecular Formula | C19H25N7O3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | COc1ccc(Nc2cc(C)nc(NCCNS(=O)(=O)c3c(C)n[nH]c3C)n2)cc1 |
| InChI | InChI=1S/C19H25N7O3S/c1-12-11-17(23-15-5-7-16(29-4)8-6-15)24-19(22-12)20-9-10-21-30(27,28)18-13(2)25-26-14(18)3/h5-8,11,21H,9-10H2,1-4H3,(H,25,26)(H2,20,22,23,24) |
| InChIKey | RWFKFXCRAXMVDC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 133.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|