C20H22BrN5O3S — CID 121075443
4-bromo-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]benzenesulfonamide (PubChem CID 121075443) has the molecular formula C20H22BrN5O3S and a molecular weight of 492.40 g/mol. Its IUPAC name is 4-bromo-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-bromo-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121075443 |
| Molecular Formula | C20H22BrN5O3S |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | 4-bromo-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
| SMILES | COc1ccc(Nc2cc(C)nc(NCCNS(=O)(=O)c3ccc(Br)cc3)n2)cc1 |
| InChI | InChI=1S/C20H22BrN5O3S/c1-14-13-19(25-16-5-7-17(29-2)8-6-16)26-20(24-14)22-11-12-23-30(27,28)18-9-3-15(21)4-10-18/h3-10,13,23H,11-12H2,1-2H3,(H2,22,24,25,26) |
| InChIKey | KFKPZLYPCJHEPR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|