C20H21F2N5O3S — CID 122294776
3,5-difluoro-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]benzenesulfonamide (PubChem CID 122294776) has the molecular formula C20H21F2N5O3S and a molecular weight of 449.48 g/mol. Its IUPAC name is 3,5-difluoro-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 3,5-difluoro-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122294776 |
| Molecular Formula | C20H21F2N5O3S |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 3,5-difluoro-N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
| SMILES | COc1ccc(Nc2cc(C)nc(NCCNS(=O)(=O)c3cc(F)cc(F)c3)n2)cc1 |
| InChI | InChI=1S/C20H21F2N5O3S/c1-13-9-19(26-16-3-5-17(30-2)6-4-16)27-20(25-13)23-7-8-24-31(28,29)18-11-14(21)10-15(22)12-18/h3-6,9-12,24H,7-8H2,1-2H3,(H2,23,25,26,27) |
| InChIKey | RPTSZNGDSCEKKP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|