C19H23N5O2S2 — CID 122325163
5-methyl-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]thiophene-2-sulfonamide (PubChem CID 122325163) has the molecular formula C19H23N5O2S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is 5-methyl-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 122325163 |
| Molecular Formula | C19H23N5O2S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 5-methyl-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(Nc2cc(C)nc(NCCNS(=O)(=O)c3ccc(C)s3)n2)cc1 |
| InChI | InChI=1S/C19H23N5O2S2/c1-13-4-7-16(8-5-13)23-17-12-14(2)22-19(24-17)20-10-11-21-28(25,26)18-9-6-15(3)27-18/h4-9,12,21H,10-11H2,1-3H3,(H2,20,22,23,24) |
| InChIKey | OUHSMGIWXLLPMQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|