C13H18ClN5O2S2 — CID 122325526
5-chloro-N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]thiophene-2-sulfonamide (PubChem CID 122325526) has the molecular formula C13H18ClN5O2S2 and a molecular weight of 375.91 g/mol. Its IUPAC name is 5-chloro-N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 122325526 |
| Molecular Formula | C13H18ClN5O2S2 |
| Molecular Weight | 375.91 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 5-chloro-N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]thiophene-2-sulfonamide |
| SMILES | CCNc1nc(C)cc(NCCNS(=O)(=O)c2ccc(Cl)s2)n1 |
| InChI | InChI=1S/C13H18ClN5O2S2/c1-3-15-13-18-9(2)8-11(19-13)16-6-7-17-23(20,21)12-5-4-10(14)22-12/h4-5,8,17H,3,6-7H2,1-2H3,(H2,15,16,18,19) |
| InChIKey | SSTCMNUCUFMAFY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.91 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|