C13H21N7O2S — CID 122325559
N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-1-methylimidazole-4-sulfonamide (PubChem CID 122325559) has the molecular formula C13H21N7O2S and a molecular weight of 339.43 g/mol. Its IUPAC name is N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-1-methylimidazole-4-sulfonamide.
| Compound Name | N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 122325559 |
| Molecular Formula | C13H21N7O2S |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-1-methylimidazole-4-sulfonamide |
| SMILES | CCNc1nc(C)cc(NCCNS(=O)(=O)c2cn(C)cn2)n1 |
| InChI | InChI=1S/C13H21N7O2S/c1-4-14-13-18-10(2)7-11(19-13)15-5-6-17-23(21,22)12-8-20(3)9-16-12/h7-9,17H,4-6H2,1-3H3,(H2,14,15,18,19) |
| InChIKey | QQRUPSMYKWDBSU-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|