C13H19N5O2S2 — CID 122325341
N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]thiophene-2-sulfonamide (PubChem CID 122325341) has the molecular formula C13H19N5O2S2 and a molecular weight of 341.46 g/mol. Its IUPAC name is N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 122325341 |
| Molecular Formula | C13H19N5O2S2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]thiophene-2-sulfonamide |
| SMILES | CCNc1nc(C)cc(NCCNS(=O)(=O)c2cccs2)n1 |
| InChI | InChI=1S/C13H19N5O2S2/c1-3-14-13-17-10(2)9-11(18-13)15-6-7-16-22(19,20)12-5-4-8-21-12/h4-5,8-9,16H,3,6-7H2,1-2H3,(H2,14,15,17,18) |
| InChIKey | JJXRZZODXWLFCD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|