C13H18N4O2S2 — CID 133472879
N-[2-[(6-ethyl-2-methylpyrimidin-4-yl)amino]ethyl]thiophene-2-sulfonamide (PubChem CID 133472879) has the molecular formula C13H18N4O2S2 and a molecular weight of 326.45 g/mol. Its IUPAC name is N-[2-[(6-ethyl-2-methylpyrimidin-4-yl)amino]ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[(6-ethyl-2-methylpyrimidin-4-yl)amino]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 133472879 |
| Molecular Formula | C13H18N4O2S2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-[2-[(6-ethyl-2-methylpyrimidin-4-yl)amino]ethyl]thiophene-2-sulfonamide |
| SMILES | CCc1cc(NCCNS(=O)(=O)c2cccs2)nc(C)n1 |
| InChI | InChI=1S/C13H18N4O2S2/c1-3-11-9-12(17-10(2)16-11)14-6-7-15-21(18,19)13-5-4-8-20-13/h4-5,8-9,15H,3,6-7H2,1-2H3,(H,14,16,17) |
| InChIKey | RVUXZZIHKVGWBK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|