C12H15ClN4O2S2 — CID 133387741
N-[2-[(6-chloro-2-methylpyrimidin-4-yl)amino]ethyl]-N-methylthiophene-2-sulfonamide (PubChem CID 133387741) has the molecular formula C12H15ClN4O2S2 and a molecular weight of 346.87 g/mol. Its IUPAC name is N-[2-[(6-chloro-2-methylpyrimidin-4-yl)amino]ethyl]-N-methylthiophene-2-sulfonamide.
| Compound Name | N-[2-[(6-chloro-2-methylpyrimidin-4-yl)amino]ethyl]-N-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 133387741 |
| Molecular Formula | C12H15ClN4O2S2 |
| Molecular Weight | 346.87 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | N-[2-[(6-chloro-2-methylpyrimidin-4-yl)amino]ethyl]-N-methylthiophene-2-sulfonamide |
| SMILES | Cc1nc(Cl)cc(NCCN(C)S(=O)(=O)c2cccs2)n1 |
| InChI | InChI=1S/C12H15ClN4O2S2/c1-9-15-10(13)8-11(16-9)14-5-6-17(2)21(18,19)12-4-3-7-20-12/h3-4,7-8H,5-6H2,1-2H3,(H,14,15,16) |
| InChIKey | QRIBJTUIVOEUJH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.87 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |