C16H18N4O2S2 — CID 133387693
N-methyl-N-[2-[(8-methylquinazolin-4-yl)amino]ethyl]thiophene-2-sulfonamide (PubChem CID 133387693) has the molecular formula C16H18N4O2S2 and a molecular weight of 362.48 g/mol. Its IUPAC name is N-methyl-N-[2-[(8-methylquinazolin-4-yl)amino]ethyl]thiophene-2-sulfonamide.
| Compound Name | N-methyl-N-[2-[(8-methylquinazolin-4-yl)amino]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 133387693 |
| Molecular Formula | C16H18N4O2S2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-methyl-N-[2-[(8-methylquinazolin-4-yl)amino]ethyl]thiophene-2-sulfonamide |
| SMILES | Cc1cccc2c(NCCN(C)S(=O)(=O)c3cccs3)ncnc12 |
| InChI | InChI=1S/C16H18N4O2S2/c1-12-5-3-6-13-15(12)18-11-19-16(13)17-8-9-20(2)24(21,22)14-7-4-10-23-14/h3-7,10-11H,8-9H2,1-2H3,(H,17,18,19) |
| InChIKey | ATBRAUIOZAEMAG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |