C17H20N4O2S2 — CID 133387842
2,5-dimethyl-N-[2-[(8-methylquinazolin-4-yl)amino]ethyl]thiophene-3-sulfonamide (PubChem CID 133387842) has the molecular formula C17H20N4O2S2 and a molecular weight of 376.51 g/mol. Its IUPAC name is 2,5-dimethyl-N-[2-[(8-methylquinazolin-4-yl)amino]ethyl]thiophene-3-sulfonamide.
| Compound Name | 2,5-dimethyl-N-[2-[(8-methylquinazolin-4-yl)amino]ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 133387842 |
| Molecular Formula | C17H20N4O2S2 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2,5-dimethyl-N-[2-[(8-methylquinazolin-4-yl)amino]ethyl]thiophene-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCNc2ncnc3c(C)cccc23)c(C)s1 |
| InChI | InChI=1S/C17H20N4O2S2/c1-11-5-4-6-14-16(11)19-10-20-17(14)18-7-8-21-25(22,23)15-9-12(2)24-13(15)3/h4-6,9-10,21H,7-8H2,1-3H3,(H,18,19,20) |
| InChIKey | WAWYRMKWPNJFDU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|