C16H16ClN3O2S2 — CID 133387627
N-[2-[(1-chloroisoquinolin-3-yl)amino]ethyl]-N-methylthiophene-2-sulfonamide (PubChem CID 133387627) has the molecular formula C16H16ClN3O2S2 and a molecular weight of 381.91 g/mol. Its IUPAC name is N-[2-[(1-chloroisoquinolin-3-yl)amino]ethyl]-N-methylthiophene-2-sulfonamide.
| Compound Name | N-[2-[(1-chloroisoquinolin-3-yl)amino]ethyl]-N-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 133387627 |
| Molecular Formula | C16H16ClN3O2S2 |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | N-[2-[(1-chloroisoquinolin-3-yl)amino]ethyl]-N-methylthiophene-2-sulfonamide |
| SMILES | CN(CCNc1cc2ccccc2c(Cl)n1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C16H16ClN3O2S2/c1-20(24(21,22)15-7-4-10-23-15)9-8-18-14-11-12-5-2-3-6-13(12)16(17)19-14/h2-7,10-11H,8-9H2,1H3,(H,18,19) |
| InChIKey | ITBNOJQEGUKESU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|