C11H13ClN4O2S2 — CID 133397375
N-[2-[(6-chloro-2-methylpyrimidin-4-yl)amino]ethyl]thiophene-2-sulfonamide (PubChem CID 133397375) has the molecular formula C11H13ClN4O2S2 and a molecular weight of 332.84 g/mol. Its IUPAC name is N-[2-[(6-chloro-2-methylpyrimidin-4-yl)amino]ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[(6-chloro-2-methylpyrimidin-4-yl)amino]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 133397375 |
| Molecular Formula | C11H13ClN4O2S2 |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | N-[2-[(6-chloro-2-methylpyrimidin-4-yl)amino]ethyl]thiophene-2-sulfonamide |
| SMILES | Cc1nc(Cl)cc(NCCNS(=O)(=O)c2cccs2)n1 |
| InChI | InChI=1S/C11H13ClN4O2S2/c1-8-15-9(12)7-10(16-8)13-4-5-14-20(17,18)11-3-2-6-19-11/h2-3,6-7,14H,4-5H2,1H3,(H,13,15,16) |
| InChIKey | VGSNXDPBCZFCOW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|