C12H11Cl2NO2S2 — CID 3810708
N-[2-(3,4-dichlorophenyl)ethyl]thiophene-2-sulfonamide (PubChem CID 3810708) has the molecular formula C12H11Cl2NO2S2 and a molecular weight of 336.27 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3810708 |
| Molecular Formula | C12H11Cl2NO2S2 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 334.96 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)ethyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCc1ccc(Cl)c(Cl)c1)c1cccs1 |
| InChI | InChI=1S/C12H11Cl2NO2S2/c13-10-4-3-9(8-11(10)14)5-6-15-19(16,17)12-2-1-7-18-12/h1-4,7-8,15H,5-6H2 |
| InChIKey | NBHFORFYXAAVDO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |