C13H15NO3S2 — CID 110667301
N-[3-(3-hydroxyphenyl)propyl]thiophene-2-sulfonamide (PubChem CID 110667301) has the molecular formula C13H15NO3S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[3-(3-hydroxyphenyl)propyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-(3-hydroxyphenyl)propyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110667301 |
| Molecular Formula | C13H15NO3S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | N-[3-(3-hydroxyphenyl)propyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCCc1cccc(O)c1)c1cccs1 |
| InChI | InChI=1S/C13H15NO3S2/c15-12-6-1-4-11(10-12)5-2-8-14-19(16,17)13-7-3-9-18-13/h1,3-4,6-7,9-10,14-15H,2,5,8H2 |
| InChIKey | DLIFQMMAKZNXFF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|