C14H17NO2S2 — CID 3802488
N-(4-phenylbutyl)thiophene-2-sulfonamide (PubChem CID 3802488) has the molecular formula C14H17NO2S2 and a molecular weight of 295.43 g/mol. Its IUPAC name is N-(4-phenylbutyl)thiophene-2-sulfonamide.
| Compound Name | N-(4-phenylbutyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3802488 |
| Molecular Formula | C14H17NO2S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | N-(4-phenylbutyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCCCc1ccccc1)c1cccs1 |
| InChI | InChI=1S/C14H17NO2S2/c16-19(17,14-10-6-12-18-14)15-11-5-4-9-13-7-2-1-3-8-13/h1-3,6-8,10,12,15H,4-5,9,11H2 |
| InChIKey | DWEUSRVATKATIH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|