C13H12N2O3S2 — CID 110707437
N-[2-(1,3-benzoxazol-5-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 110707437) has the molecular formula C13H12N2O3S2 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-[2-(1,3-benzoxazol-5-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(1,3-benzoxazol-5-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110707437 |
| Molecular Formula | C13H12N2O3S2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | N-[2-(1,3-benzoxazol-5-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCc1ccc2ocnc2c1)c1cccs1 |
| InChI | InChI=1S/C13H12N2O3S2/c16-20(17,13-2-1-7-19-13)15-6-5-10-3-4-12-11(8-10)14-9-18-12/h1-4,7-9,15H,5-6H2 |
| InChIKey | SROPISFGVFUZEE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |