C11H12N2O3 — CID 110707385
methyl N-[2-(1,3-benzoxazol-5-yl)ethyl]carbamate (PubChem CID 110707385) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is methyl N-[2-(1,3-benzoxazol-5-yl)ethyl]carbamate.
| Compound Name | methyl N-[2-(1,3-benzoxazol-5-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 110707385 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | methyl N-[2-(1,3-benzoxazol-5-yl)ethyl]carbamate |
| SMILES | COC(=O)NCCc1ccc2ocnc2c1 |
| InChI | InChI=1S/C11H12N2O3/c1-15-11(14)12-5-4-8-2-3-10-9(6-8)13-7-16-10/h2-3,6-7H,4-5H2,1H3,(H,12,14) |
| InChIKey | UEBJLBGYZHTZBU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |