C11H13N3O2 — CID 115169389
1-[2-(1,3-benzoxazol-6-yl)ethyl]-3-methylurea (PubChem CID 115169389) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 1-[2-(1,3-benzoxazol-6-yl)ethyl]-3-methylurea.
| Compound Name | 1-[2-(1,3-benzoxazol-6-yl)ethyl]-3-methylurea |
|---|---|
| PubChem CID | 115169389 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 1-[2-(1,3-benzoxazol-6-yl)ethyl]-3-methylurea |
| SMILES | CNC(=O)NCCc1ccc2ncoc2c1 |
| InChI | InChI=1S/C11H13N3O2/c1-12-11(15)13-5-4-8-2-3-9-10(6-8)16-7-14-9/h2-3,6-7H,4-5H2,1H3,(H2,12,13,15) |
| InChIKey | MMYIQUVJNGYLEM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |