C16H20N2O2 — CID 110790911
N-[2-(1,3-benzoxazol-6-yl)ethyl]cyclohexanecarboxamide (PubChem CID 110790911) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-[2-(1,3-benzoxazol-6-yl)ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-(1,3-benzoxazol-6-yl)ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 110790911 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-[2-(1,3-benzoxazol-6-yl)ethyl]cyclohexanecarboxamide |
| SMILES | O=C(NCCc1ccc2ncoc2c1)C1CCCCC1 |
| InChI | InChI=1S/C16H20N2O2/c19-16(13-4-2-1-3-5-13)17-9-8-12-6-7-14-15(10-12)20-11-18-14/h6-7,10-11,13H,1-5,8-9H2,(H,17,19) |
| InChIKey | IPHNIDGMNMCYMV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |