C14H15N3O3 — CID 110741045
N-[2-(1,3-benzoxazol-5-yl)ethyl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 110741045) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is N-[2-(1,3-benzoxazol-5-yl)ethyl]-5-oxopyrrolidine-2-carboxamide.
| Compound Name | N-[2-(1,3-benzoxazol-5-yl)ethyl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110741045 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-[2-(1,3-benzoxazol-5-yl)ethyl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | O=C1CCC(C(=O)NCCc2ccc3ocnc3c2)N1 |
| InChI | InChI=1S/C14H15N3O3/c18-13-4-2-10(17-13)14(19)15-6-5-9-1-3-12-11(7-9)16-8-20-12/h1,3,7-8,10H,2,4-6H2,(H,15,19)(H,17,18) |
| InChIKey | AXRAHVNDPVFYOI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |