About (2R)-N-[2-(3,4-dichlorophenyl)ethyl]-6-oxopiperidine-2-carboxamide
(2R)-N-[2-(3,4-dichlorophenyl)ethyl]-6-oxopiperidine-2-carboxamide (PubChem CID 146133576) has the molecular formula C14H16Cl2N2O2
and a molecular weight of 315.20 g/mol. Its IUPAC name is (2R)-N-[2-(3,4-dichlorophenyl)ethyl]-6-oxopiperidine-2-carboxamide.
Molecular Properties
| Compound Name | (2R)-N-[2-(3,4-dichlorophenyl)ethyl]-6-oxopiperidine-2-carboxamide |
| PubChem CID | 146133576 |
| Molecular Formula | C14H16Cl2N2O2 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | (2R)-N-[2-(3,4-dichlorophenyl)ethyl]-6-oxopiperidine-2-carboxamide |
| SMILES | O=C1CCC[C@H](C(=O)NCCc2ccc(Cl)c(Cl)c2)N1 |
| InChI | InChI=1S/C14H16Cl2N2O2/c15-10-5-4-9(8-11(10)16)6-7-17-14(20)12-2-1-3-13(19)18-12/h4-5,8,12H,1-3,6-7H2,(H,17,20)(H,18,19)/t12-/m1/s1 |
| InChIKey | NVKRHBHQRCOMQP-GFCCVEGCSA-N |
| XLogP | 2.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-N-[2-(3,4-dichlorophenyl)ethyl]-6-oxopiperidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-[2-(3,4-dichlorophenyl)ethyl]-6-oxopiperidine-2-carboxamide?
The IUPAC name of (2R)-N-[2-(3,4-dichlorophenyl)ethyl]-6-oxopiperidine-2-carboxamide (CID 146133576) is (2R)-N-[2-(3,4-dichlorophenyl)ethyl]-6-oxopiperidine-2-carboxamide.
What is the SMILES notation for (2R)-N-[2-(3,4-dichlorophenyl)ethyl]-6-oxopiperidine-2-carboxamide?
The canonical SMILES for (2R)-N-[2-(3,4-dichlorophenyl)ethyl]-6-oxopiperidine-2-carboxamide is O=C1CCC[C@H](C(=O)NCCc2ccc(Cl)c(Cl)c2)N1.
What is the InChIKey of (2R)-N-[2-(3,4-dichlorophenyl)ethyl]-6-oxopiperidine-2-carboxamide?
The InChIKey is NVKRHBHQRCOMQP-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H16Cl2N2O2/c15-10-5-4-9(8-11(10)16)6-7-17-14(20)12-2-1-3-13(19)18-12/h4-5,8,12H,1-3,6-7H2,(H,17,20)(H,18,19)/t12-/m1/s1.
What are the key properties of (2R)-N-[2-(3,4-dichlorophenyl)ethyl]-6-oxopiperidine-2-carboxamide?
(2R)-N-[2-(3,4-dichlorophenyl)ethyl]-6-oxopiperidine-2-carboxamide has a molecular weight of 315.20 g/mol, XLogP of 2.32, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-[2-(3,4-dichlorophenyl)ethyl]-6-oxopiperidine-2-carboxamide is sourced from PubChem (CID 146133576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).