C16H13ClN2O2 — CID 110707375
N-[2-(1,3-benzoxazol-5-yl)ethyl]-3-chlorobenzamide (PubChem CID 110707375) has the molecular formula C16H13ClN2O2 and a molecular weight of 300.75 g/mol. Its IUPAC name is N-[2-(1,3-benzoxazol-5-yl)ethyl]-3-chlorobenzamide.
| Compound Name | N-[2-(1,3-benzoxazol-5-yl)ethyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 110707375 |
| Molecular Formula | C16H13ClN2O2 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | N-[2-(1,3-benzoxazol-5-yl)ethyl]-3-chlorobenzamide |
| SMILES | O=C(NCCc1ccc2ocnc2c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H13ClN2O2/c17-13-3-1-2-12(9-13)16(20)18-7-6-11-4-5-15-14(8-11)19-10-21-15/h1-5,8-10H,6-7H2,(H,18,20) |
| InChIKey | JGXBFPYMGYJPQX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |