C18H19N3O2 — CID 110796046
N-[2-(1,3-benzoxazol-6-yl)ethyl]-3-(dimethylamino)benzamide (PubChem CID 110796046) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is N-[2-(1,3-benzoxazol-6-yl)ethyl]-3-(dimethylamino)benzamide.
| Compound Name | N-[2-(1,3-benzoxazol-6-yl)ethyl]-3-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 110796046 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N-[2-(1,3-benzoxazol-6-yl)ethyl]-3-(dimethylamino)benzamide |
| SMILES | CN(C)c1cccc(C(=O)NCCc2ccc3ncoc3c2)c1 |
| InChI | InChI=1S/C18H19N3O2/c1-21(2)15-5-3-4-14(11-15)18(22)19-9-8-13-6-7-16-17(10-13)23-12-20-16/h3-7,10-12H,8-9H2,1-2H3,(H,19,22) |
| InChIKey | KEKDJMQIDHNPPE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |