C16H15N3O4S — CID 110765059
N-[2-(4-sulfamoylphenyl)ethyl]-1,3-benzoxazole-6-carboxamide (PubChem CID 110765059) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is N-[2-(4-sulfamoylphenyl)ethyl]-1,3-benzoxazole-6-carboxamide.
| Compound Name | N-[2-(4-sulfamoylphenyl)ethyl]-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 110765059 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-[2-(4-sulfamoylphenyl)ethyl]-1,3-benzoxazole-6-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)c2ccc3ncoc3c2)cc1 |
| InChI | InChI=1S/C16H15N3O4S/c17-24(21,22)13-4-1-11(2-5-13)7-8-18-16(20)12-3-6-14-15(9-12)23-10-19-14/h1-6,9-10H,7-8H2,(H,18,20)(H2,17,21,22) |
| InChIKey | MSYWCLWFCAIOGZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |