C17H15FN2O2 — CID 110707405
N-[2-(1,3-benzoxazol-5-yl)ethyl]-2-(2-fluorophenyl)acetamide (PubChem CID 110707405) has the molecular formula C17H15FN2O2 and a molecular weight of 298.32 g/mol. Its IUPAC name is N-[2-(1,3-benzoxazol-5-yl)ethyl]-2-(2-fluorophenyl)acetamide.
| Compound Name | N-[2-(1,3-benzoxazol-5-yl)ethyl]-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 110707405 |
| Molecular Formula | C17H15FN2O2 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-[2-(1,3-benzoxazol-5-yl)ethyl]-2-(2-fluorophenyl)acetamide |
| SMILES | O=C(Cc1ccccc1F)NCCc1ccc2ocnc2c1 |
| InChI | InChI=1S/C17H15FN2O2/c18-14-4-2-1-3-13(14)10-17(21)19-8-7-12-5-6-16-15(9-12)20-11-22-16/h1-6,9,11H,7-8,10H2,(H,19,21) |
| InChIKey | OESPHEKKMMEOPJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |