C16H14N2O5S — CID 110707436
N-[2-(1,3-benzoxazol-5-yl)ethyl]-1,3-benzodioxole-5-sulfonamide (PubChem CID 110707436) has the molecular formula C16H14N2O5S and a molecular weight of 346.36 g/mol. Its IUPAC name is N-[2-(1,3-benzoxazol-5-yl)ethyl]-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-[2-(1,3-benzoxazol-5-yl)ethyl]-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 110707436 |
| Molecular Formula | C16H14N2O5S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | N-[2-(1,3-benzoxazol-5-yl)ethyl]-1,3-benzodioxole-5-sulfonamide |
| SMILES | O=S(=O)(NCCc1ccc2ocnc2c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H14N2O5S/c19-24(20,12-2-4-15-16(8-12)23-10-22-15)18-6-5-11-1-3-14-13(7-11)17-9-21-14/h1-4,7-9,18H,5-6,10H2 |
| InChIKey | OAIBQVXPZHJRCB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |