C15H12N2O5S — CID 110785042
N-(1,3-benzoxazol-6-ylmethyl)-1,3-benzodioxole-5-sulfonamide (PubChem CID 110785042) has the molecular formula C15H12N2O5S and a molecular weight of 332.34 g/mol. Its IUPAC name is N-(1,3-benzoxazol-6-ylmethyl)-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-(1,3-benzoxazol-6-ylmethyl)-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 110785042 |
| Molecular Formula | C15H12N2O5S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | N-(1,3-benzoxazol-6-ylmethyl)-1,3-benzodioxole-5-sulfonamide |
| SMILES | O=S(=O)(NCc1ccc2ncoc2c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H12N2O5S/c18-23(19,11-2-4-13-15(6-11)22-9-21-13)17-7-10-1-3-12-14(5-10)20-8-16-12/h1-6,8,17H,7,9H2 |
| InChIKey | GYJNUGNNNRMIQQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |